Allyl heptafluoroisopropyl ether structure
|
Common Name | Allyl heptafluoroisopropyl ether | ||
|---|---|---|---|---|
| CAS Number | 15242-17-8 | Molecular Weight | 226.09200 | |
| Density | 1.351g/cm3 | Boiling Point | 86.4ºC at 760mmHg | |
| Molecular Formula | C6H5F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 11.3ºC | |
| Name | Allyl heptafluoroisopropyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 86.4ºC at 760mmHg |
| Molecular Formula | C6H5F7O |
| Molecular Weight | 226.09200 |
| Flash Point | 11.3ºC |
| Exact Mass | 226.02300 |
| PSA | 9.23000 |
| LogP | 2.97940 |
| Vapour Pressure | 2640mmHg at 25°C |
| Index of Refraction | 1.301 |
| InChIKey | FXUHCQHWDACOKK-UHFFFAOYSA-N |
| SMILES | C=CCOC(F)(C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi: Irritant;F: Flammable; |
|---|---|
| Risk Phrases | 10 |
| Safety Phrases | 16-26-36 |
| RIDADR | UN 3271 |
| HS Code | 2909199090 |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,1,1,2,3,3,3-heptafluoro-2-prop-2-enoxypropane |