4-(hydroxyamino)-2-nitrobenzoic acid structure
|
Common Name | 4-(hydroxyamino)-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 15253-04-0 | Molecular Weight | 198.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(hydroxyamino)-2-nitrobenzoic acid |
|---|
| Molecular Formula | C7H6N2O5 |
|---|---|
| Molecular Weight | 198.13300 |
| Exact Mass | 198.02800 |
| PSA | 115.38000 |
| LogP | 1.69030 |
| InChIKey | RSJSVDBNCYNCTI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NO)cc1[N+](=O)[O-] |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |