4-Hydroxy-2-nitrobenzoic acid structure
|
Common Name | 4-Hydroxy-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 74230-08-3 | Molecular Weight | 183.118 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 414.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H5NO5 | Melting Point | 230ºC (dec.) | |
| MSDS | N/A | Flash Point | 190.8±15.8 °C | |
| Name | 4-Hydroxy-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.0±40.0 °C at 760 mmHg |
| Melting Point | 230ºC (dec.) |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.118 |
| Flash Point | 190.8±15.8 °C |
| Exact Mass | 183.016769 |
| PSA | 103.35000 |
| LogP | 1.80 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | FNDZIIJCKXGZJA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(O)cc1[N+](=O)[O-] |
| HS Code | 2918290000 |
|---|
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 4-hydroxy-2-nitro- |
| 4-Hydroxy-2-nitrobenzoic acid |