trans-3-(2,5-dimethylbenzoyl)acrylic acid structure
|
Common Name | trans-3-(2,5-dimethylbenzoyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 15254-22-5 | Molecular Weight | 204.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O3 |
|---|---|
| Molecular Weight | 204.22200 |
| Exact Mass | 204.07900 |
| PSA | 54.37000 |
| LogP | 2.12690 |
| InChIKey | YHCFVGCMSKTDFZ-AATRIKPKSA-N |
| SMILES | Cc1ccc(C)c(C(=O)C=CC(=O)O)c1 |
| HS Code | 2918300090 |
|---|
|
~95%
trans-3-(2,5-di... CAS#:15254-22-5 |
| Literature: Drakulic, Branko J.; Stanojkovic, Tatjana P.; Zizak, Zeljko S.; Dabovic, Milan M. European Journal of Medicinal Chemistry, 2011 , vol. 46, # 8 p. 3265 - 3273 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Butenoic acid,4-(2,5-dimethylphenyl)-4-oxo |
| trans-3-(2,5-dimethylbenzoyl)acrylic acid |
| Acrylicacid,3-(2,5-dimethylbenzoyl)-(8CI) |
| (E)-4-(2,5-dimethylphenyl)-4-oxo-2-butenoic acid |
| b-2,5-Dimethylbenzoylacrylic acid |
| 4-oxo-4-(2.5-dimethyl-phenyl)-trans-crotonic acid |
| 3-(2,5-Dimethylbenzoyl)acrylic acid |
| 4-Oxo-4-(2.5-dimethyl-phenyl)-trans-crotonsaeure |