2-(3-Chloro-4-methylbenzoyl)benzoic acid structure
|
Common Name | 2-(3-Chloro-4-methylbenzoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 15254-27-0 | Molecular Weight | 274.69900 | |
| Density | 1.318g/cm3 | Boiling Point | 485.1ºC at 760mmHg | |
| Molecular Formula | C15H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.2ºC | |
| Name | 2-(3-Chloro-4-methylbenzoyl)benzoic acid |
|---|
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 485.1ºC at 760mmHg |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.69900 |
| Flash Point | 247.2ºC |
| Exact Mass | 274.04000 |
| PSA | 54.37000 |
| LogP | 3.57760 |
| Vapour Pressure | 3.18E-10mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | UIABSHHBLMGEQI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)O)cc1Cl |
| HS Code | 2918300090 |
|---|
|
~%
2-(3-Chloro-4-m... CAS#:15254-27-0 |
| Literature: I.G. Farbenind. Patent: DE560352 , 1931 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 19, p. 1918 |
|
~%
Detail
|
| Literature: I. G. Farbenind. Patent: DE530408 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 18, p. 540 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |