2-(4-Methylbenzoyl)benzoic acid structure
|
Common Name | 2-(4-Methylbenzoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 85-55-2 | Molecular Weight | 240.254 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 457.1±28.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | 137-139 °C(lit.) | |
| MSDS | N/A | Flash Point | 244.4±20.5 °C | |
| Name | 2-(p-Toluoyl)benzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 457.1±28.0 °C at 760 mmHg |
| Melting Point | 137-139 °C(lit.) |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.254 |
| Flash Point | 244.4±20.5 °C |
| Exact Mass | 240.078644 |
| PSA | 54.37000 |
| LogP | 2.77 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | ICQOWIXIHDDXDI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)O)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzoic acid, 2-(4-methylbenzoyl)- |
| EINECS 201-614-3 |
| MFCD00020287 |
| 2-(4-Methylbenzoyl)benzoic acid |