3-Amino-3-(2,4-dichlorophenyl)propanoic acid
Modify Date: 2025-09-19 19:23:21
3-Amino-3-(2,4-dichlorophenyl)propanoic acid structure
|
Common Name | 3-Amino-3-(2,4-dichlorophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 152606-17-2 | Molecular Weight | 234.079 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 371.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.3±27.9 °C | |
| Name | 3-amino-3-(2,4-dichlorophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 371.1±42.0 °C at 760 mmHg |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.079 |
| Flash Point | 178.3±27.9 °C |
| Exact Mass | 233.001038 |
| PSA | 63.32000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | QGHQDRDWQIHGKZ-UHFFFAOYSA-N |
| SMILES | NC(CC(=O)O)c1ccc(Cl)cc1Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzenepropanoic acid,b-amino-2,4-dichloro |
| Benzenepropanoic acid, β-amino-2,4-dichloro- |
| 3-Amino-3-(2,4-dichlorophenyl)propanoic acid |
| 3-Amino-3-(2,4-dichlorophenyl)-propionic acid |