4-Pteridinamine,2-(methylthio)-6,7-diphenyl- structure
|
Common Name | 4-Pteridinamine,2-(methylthio)-6,7-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 15263-43-1 | Molecular Weight | 345.42100 | |
| Density | 1.39g/cm3 | Boiling Point | 561.9ºC at 760mmHg | |
| Molecular Formula | C19H15N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.6ºC | |
| Name | 2-methylsulfanyl-6,7-diphenylpteridin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 561.9ºC at 760mmHg |
| Molecular Formula | C19H15N5S |
| Molecular Weight | 345.42100 |
| Flash Point | 293.6ºC |
| Exact Mass | 345.10500 |
| PSA | 102.88000 |
| LogP | 4.63910 |
| Vapour Pressure | 1.19E-12mmHg at 25°C |
| Index of Refraction | 1.752 |
| InChIKey | BPYYFYLFWDJZQW-UHFFFAOYSA-N |
| SMILES | CSc1nc(N)c2nc(-c3ccccc3)c(-c3ccccc3)nc2n1 |
|
~%
4-Pteridinamine... CAS#:15263-43-1 |
| Literature: Taylor; Cain Journal of the American Chemical Society, 1952 , vol. 74, p. 1644,1646 |
|
~%
4-Pteridinamine... CAS#:15263-43-1 |
| Literature: Taylor; Cain Journal of the American Chemical Society, 1952 , vol. 74, p. 1644,1646 |
| 2-Methylmercapto-6,7-diphenyl-pteridin-4-ylamin |
| 2-methylsulfanyl-6,7-diphenyl-pteridin-4-ylamine |