5-Bromo-3-methoxy-2-nitro-pyridine structure
|
Common Name | 5-Bromo-3-methoxy-2-nitro-pyridine | ||
|---|---|---|---|---|
| CAS Number | 152684-26-9 | Molecular Weight | 233.020 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 334.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C6H5BrN2O3 | Melting Point | 112℃ | |
| MSDS | N/A | Flash Point | 156.1±26.5 °C | |
| Name | 5-Bromo-3-methoxy-2-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 334.6±37.0 °C at 760 mmHg |
| Melting Point | 112℃ |
| Molecular Formula | C6H5BrN2O3 |
| Molecular Weight | 233.020 |
| Flash Point | 156.1±26.5 °C |
| Exact Mass | 231.948349 |
| PSA | 67.94000 |
| LogP | 1.71 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | OLWFTDPHNVYMMN-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)cnc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
|
~83%
5-Bromo-3-metho... CAS#:152684-26-9 |
| Literature: Satoh, Motohide; Aramaki, Hisateru; Nakamura, Hiroshi; Inoue, Masafumi; Kawakami, Hiroshi; Shinkai, Hisashi; Matsuzaki, Yuji; Yamataka, Kazunobu Patent: US2006/84665 A1, 2006 ; Location in patent: Page/Page column 70 ; |
|
~%
5-Bromo-3-metho... CAS#:152684-26-9 |
| Literature: Acta Chemica Scandinavica, , vol. 47, # 8 p. 805 - 812 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo-2-methoxy-3-nitropyridine |
| 5-Bromo-3-methoxy-2-nitropyridine |
| Pyridine, 5-bromo-2-methoxy-3-nitro- |
| Pyridine, 5-bromo-3-methoxy-2-nitro- |