dibenzyl 5-aminobenzene-1,3-dicarboxylate structure
|
Common Name | dibenzyl 5-aminobenzene-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 152699-63-3 | Molecular Weight | 361.39100 | |
| Density | 1.25g/cm3 | Boiling Point | 561.3ºC at 760mmHg | |
| Molecular Formula | C22H19NO4 | Melting Point | 116-118ºC | |
| MSDS | N/A | Flash Point | 233.1ºC | |
| Name | dibenzyl 5-aminobenzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 561.3ºC at 760mmHg |
| Melting Point | 116-118ºC |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.39100 |
| Flash Point | 233.1ºC |
| Exact Mass | 361.13100 |
| PSA | 78.62000 |
| LogP | 4.56400 |
| Vapour Pressure | 1.26E-12mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | VDJWRMQQXQBYIO-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(=O)OCc2ccccc2)cc(C(=O)OCc2ccccc2)c1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2922499990 |
|
~22%
dibenzyl 5-amin... CAS#:152699-63-3 |
| Literature: Barvian, Nicole Chantel; Connor, David Thomas; Dyer, Richard Dennis; Johnson, Adam Richard; Patt, William Chester Patent: US2002/156061 A1, 2002 ; |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3,5-dibenzyloxycarbonylaniline |
| MFCD03093065 |
| DIBENZYL 5-AMINOISOPHTHALATE |
| 5-Amino-isophthalic acid dibenzyl ester |