tris(2-methylpropyl) benzene-1,2,4-tricarboxylate structure
|
Common Name | tris(2-methylpropyl) benzene-1,2,4-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1528-52-5 | Molecular Weight | 378.45900 | |
| Density | 1.072g/cm3 | Boiling Point | 439ºC at 760mmHg | |
| Molecular Formula | C21H30O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.7ºC | |
| Name | tris(2-methylpropyl) benzene-1,2,4-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.072g/cm3 |
|---|---|
| Boiling Point | 439ºC at 760mmHg |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.45900 |
| Flash Point | 186.7ºC |
| Exact Mass | 378.20400 |
| PSA | 78.90000 |
| LogP | 4.12500 |
| Vapour Pressure | 6.62E-08mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | GQBWSGXZXIZPAF-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)c1ccc(C(=O)OCC(C)C)c(C(=O)OCC(C)C)c1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 216-209-7 |
| Trimellitsaeure-triisobutylester |
| triisobutyl benzene-1,2,4-tricarboxylate |