Diisobutyl terephthalate structure
|
Common Name | Diisobutyl terephthalate | ||
|---|---|---|---|---|
| CAS Number | 18699-48-4 | Molecular Weight | 278.34300 | |
| Density | 1.05g/cm3 | Boiling Point | 300.1ºC at 760mmHg | |
| Molecular Formula | C16H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | bis(2-methylpropyl) benzene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 300.1ºC at 760mmHg |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.34300 |
| Flash Point | 156.6ºC |
| Exact Mass | 278.15200 |
| PSA | 52.60000 |
| LogP | 3.31220 |
| Vapour Pressure | 0.00114mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | LQKWPGAPADIOSS-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)c1ccc(C(=O)OCC(C)C)cc1 |
| HS Code | 2917399090 |
|---|
|
~%
Detail
|
| Literature: Eastman Chemical Company Patent: US7361779 B1, 2008 ; Location in patent: Page/Page column 3; 4; 5; 6 ; |
|
~%
Diisobutyl tere... CAS#:18699-48-4 |
| Literature: Pfannl Monatshefte fuer Chemie, 1911 , vol. 32, p. 513 |
|
~%
Diisobutyl tere... CAS#:18699-48-4 |
| Literature: Dow Chem. Co. Patent: US2871256 , 1956 ; |
|
~%
Diisobutyl tere... CAS#:18699-48-4 |
| Literature: Berger Chemische Berichte, 1877 , vol. 10, p. 1742 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Di-isobutyl-terephthalsaeure |
| diisobutyl terephalate |
| EINECS 242-512-9 |
| TEREPHTHALIC ACID,DIISOBUTYL ESTER |
| Terephthalsaeure-diisobutylester |
| Diisobutyl terephthalate |