2(3H)-Furanone,dihydro-3-[(3,4,5-trimethoxyphenyl)methylene]- structure
|
Common Name | 2(3H)-Furanone,dihydro-3-[(3,4,5-trimethoxyphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 1530-58-1 | Molecular Weight | 264.27400 | |
| Density | 1.223g/cm3 | Boiling Point | 460.4ºC at 760mmHg | |
| Molecular Formula | C14H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207ºC | |
| Name | 3-[(3,4,5-trimethoxyphenyl)methylidene]oxolan-2-one |
|---|
| Density | 1.223g/cm3 |
|---|---|
| Boiling Point | 460.4ºC at 760mmHg |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.27400 |
| Flash Point | 207ºC |
| Exact Mass | 264.10000 |
| PSA | 53.99000 |
| LogP | 2.04270 |
| Vapour Pressure | 1.17E-08mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | GMQGMAWKJNOEKX-UXBLZVDNSA-N |
| SMILES | COc1cc(C=C2CCOC2=O)cc(OC)c1OC |
|
~59%
2(3H)-Furanone,... CAS#:1530-58-1 |
| Literature: Katsumi; Kondo; Yamashita; Hidaka; Hosoe; Watanabe Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 1 p. 121 - 129 |
|
~%
2(3H)-Furanone,... CAS#:1530-58-1 |
| Literature: Zimmer; Rothe Journal of Organic Chemistry, 1959 , vol. 24, p. 28,30 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |