N-Desbutyl-N-(2-ethylhexyl) Bumetanide structure
|
Common Name | N-Desbutyl-N-(2-ethylhexyl) Bumetanide | ||
|---|---|---|---|---|
| CAS Number | 153012-65-8 | Molecular Weight | 420.52200 | |
| Density | 1.248±0.06 g/cm3(Predicted | Boiling Point | 597.7±60.0 °C(Predicted) | |
| Molecular Formula | C21H28N2O5S | Melting Point | >152°C (dec.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-Desbutyl-N-(2-ethylhexyl) Bumetanide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248±0.06 g/cm3(Predicted |
|---|---|
| Boiling Point | 597.7±60.0 °C(Predicted) |
| Melting Point | >152°C (dec.) |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.52200 |
| Exact Mass | 420.17200 |
| PSA | 127.10000 |
| LogP | 6.30690 |
| Appearance of Characters | Solid,Off-White to Pale Beige |
| InChIKey | MDNHIMFOFVKGQA-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CNc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| Storage condition | Refrigerator, under inert atmosphere |
| Water Solubility | DMSO (Slightly), Methanol (Slightly) |
| 3-(2-ethylhexylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
| PF-2825 |