N,N-Bis(2-ethylhexyl)-[(1,2,4-triazol-1-yl)methyl]amin structure
|
Common Name | N,N-Bis(2-ethylhexyl)-[(1,2,4-triazol-1-yl)methyl]amin | ||
|---|---|---|---|---|
| CAS Number | 91273-04-0 | Molecular Weight | 322.53200 | |
| Density | 0.95g/cm3 | Boiling Point | 423.6ºC at 760mmHg | |
| Molecular Formula | C19H38N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210ºC | |
| Name | 2-ethyl-N-(2-ethylhexyl)-N-(1,2,4-triazol-1-ylmethyl)hexan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.95g/cm3 |
|---|---|
| Boiling Point | 423.6ºC at 760mmHg |
| Molecular Formula | C19H38N4 |
| Molecular Weight | 322.53200 |
| Flash Point | 210ºC |
| Exact Mass | 322.31000 |
| PSA | 33.95000 |
| LogP | 4.97040 |
| Index of Refraction | 1.509 |
| InChIKey | AVBBHCMDRGQBNW-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)Cn1cncn1 |
| Hazard Codes | C: Corrosive;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | 34-43-51/53 |
| Safety Phrases | 26-28-36/37/39-45-61 |
| 1H-1,2,4-Triazole-1-methanamine,N,N-bis(2-ethylhexyl) |
| 2-ethyl-N-(2-ethylhexyl)-N-(1H-1,2,4-triazol-1-ylmethyl)hexan-1-amine |