Valeric acid 4-piperidinocyclohexyl ester structure
|
Common Name | Valeric acid 4-piperidinocyclohexyl ester | ||
|---|---|---|---|---|
| CAS Number | 1532-02-1 | Molecular Weight | 267.40700 | |
| Density | 1g/cm3 | Boiling Point | 346.5ºC at 760mmHg | |
| Molecular Formula | C16H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.6ºC | |
| Name | (4-piperidin-1-ylcyclohexyl) pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 346.5ºC at 760mmHg |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.40700 |
| Flash Point | 108.6ºC |
| Exact Mass | 267.22000 |
| PSA | 29.54000 |
| LogP | 3.45480 |
| Vapour Pressure | 5.72E-05mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | BELYKPLCHUFRRA-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)OC1CCC(N2CCCCC2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(piperidin-1-yl)cyclohexyl pentanoate |
| Cyclohexanol,4-piperidino-,valerate |
| Valeric acid,4-piperidinocyclohexyl ester |
| Pentanoic acid,4-(1-piperidinyl)cyclohexyl ester |
| 4-Piperidinocyclohexyl valerate |
| 4-Piperidinocyclohexanol-valerat |