TGR-1202 R-enantiomer structure
|
Common Name | TGR-1202 R-enantiomer | ||
|---|---|---|---|---|
| CAS Number | 1532533-69-9 | Molecular Weight | 571.549 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 737.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C31H24F3N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 399.8±32.9 °C | |
Use of TGR-1202 R-enantiomerUmbralisib R-enantiomer (TGR-1202 R-enantiomer) is a PI3Kδ inhibitor, which is the less active enantiomer of TGR-1202. |
| Name | TGR-1202 R-enantiomer |
|---|---|
| Synonym | More Synonyms |
| Description | Umbralisib R-enantiomer (TGR-1202 R-enantiomer) is a PI3Kδ inhibitor, which is the less active enantiomer of TGR-1202. |
|---|---|
| Related Catalog | |
| Target |
PI3Kδ |
| In Vitro | Umbralisib R-enantiomer (TGR-1202 R-enantiomer) (Formula A) exhibits a 50% inhibitory concentration (IC50) with respect to the δ type PI3-kinase that is at least 20-fold lower than the inhibitor's IC50 with respect to the rest of the other PI3K isoforms (i.e., a, β, and γ)[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 737.4±60.0 °C at 760 mmHg |
| Molecular Formula | C31H24F3N5O3 |
| Molecular Weight | 571.549 |
| Flash Point | 399.8±32.9 °C |
| Exact Mass | 571.183105 |
| LogP | 6.66 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | IUVCFHHAEHNCFT-MRXNPFEDSA-N |
| SMILES | CC(C)Oc1ccc(-c2nn(C(C)c3oc4ccc(F)cc4c(=O)c3-c3cccc(F)c3)c3ncnc(N)c23)cc1F |
| Storage condition | 2-8℃ |
| 2-{(1R)-1-[4-Amino-3-(3-fluoro-4-isopropoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl]ethyl}-6-fluoro-3-(3-fluorophenyl)-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 2-[(1R)-1-[4-amino-3-[3-fluoro-4-(1-methylethoxy)phenyl]-1H-pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-6-fluoro-3-(3-fluorophenyl)- |