3'-(Trifluoromethyl)propiophenone structure
|
Common Name | 3'-(Trifluoromethyl)propiophenone | ||
|---|---|---|---|---|
| CAS Number | 1533-03-5 | Molecular Weight | 202.173 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 201.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H9F3O | Melting Point | 18 °C | |
| MSDS | USA | Flash Point | 91.1±17.4 °C | |
| Name | 3′-(Trifluoromethyl)propiophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 201.7±35.0 °C at 760 mmHg |
| Melting Point | 18 °C |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.173 |
| Flash Point | 91.1±17.4 °C |
| Exact Mass | 202.060547 |
| PSA | 17.07000 |
| LogP | 3.25 |
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | UBTPNKXHYILGJU-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cccc(C(F)(F)F)c1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914399090 |
|
~%
3'-(Trifluorome... CAS#:1533-03-5 |
| Literature: US6211413 B1, ; |
|
~%
3'-(Trifluorome... CAS#:1533-03-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 7, # 1 p. 1 - 6 |
|
~%
3'-(Trifluorome... CAS#:1533-03-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 7, # 1 p. 1 - 6 |
|
~%
3'-(Trifluorome... CAS#:1533-03-5 |
| Literature: European Journal of Medicinal Chemistry, , vol. 30, # 1 p. 85 - 94 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Propiophenone, 3'-(trifluoromethyl) |
| 1-[3-(Trifluoromethyl)phenyl]propanone |
| m-(Trifluoromethyl)propiophenone |
| FXFFR CV2 |
| MFCD00039227 |
| 3-(Trifluoromethyl)propiophenone |
| 1-[3-(Trifluoromethyl)phenyl]-1-propanone |
| Ethyl 3-(trifluoromethyl)phenyl ketone |
| 1-[3-(Trifluoromethyl)phenyl]propan-1-one |
| 3'-(Trifluoromethyl)propiophenone |
| 1-(3-(Trifluoromethyl)phenyl)propan-1-one |
| M-Trifluoromethylpropiophenone |
| 1-Propanone, 1-[3-(trifluoromethyl)phenyl]- |