(4-bromophenyl)sulfanyl-tert-butyl-dimethylsilane structure
|
Common Name | (4-bromophenyl)sulfanyl-tert-butyl-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 153312-70-0 | Molecular Weight | 303.33400 | |
| Density | 1.205g/cm3 | Boiling Point | 120-130ºC0.2-0.3 mm Hg(lit.) | |
| Molecular Formula | C12H19BrSSi | Melting Point | 42-44ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4-bromophenyl)sulfanyl-tert-butyl-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 120-130ºC0.2-0.3 mm Hg(lit.) |
| Melting Point | 42-44ºC(lit.) |
| Molecular Formula | C12H19BrSSi |
| Molecular Weight | 303.33400 |
| Flash Point | >230 °F |
| Exact Mass | 302.01600 |
| PSA | 25.30000 |
| LogP | 5.54640 |
| Vapour Pressure | 0.001mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | ZVSDFKXSTADQGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)Sc1ccc(Br)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
|
~92%
(4-bromophenyl)... CAS#:153312-70-0 |
| Literature: Brikh, Abdelghani; Morin, Christophe Journal of Organometallic Chemistry, 1999 , vol. 581, # 1-2 p. 82 - 86 |
| (4-bromophenylsulfanyl)-tert-butyldimethylsilane |
| MFCD05664244 |
| I09-2972 |
| (4-bromophenylthio)-dimethyl-tert-butyl-silane |