n-(phenoxycarbonyl)-l-valine methyl ester structure
|
Common Name | n-(phenoxycarbonyl)-l-valine methyl ester | ||
|---|---|---|---|---|
| CAS Number | 153441-77-1 | Molecular Weight | 251.27800 | |
| Density | 1.128g/cm3 | Boiling Point | 335ºC at 760mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | 58-62ºC(lit.) | |
| MSDS | N/A | Flash Point | 156.4ºC | |
| Name | n-(phenoxycarbonyl)-l-valine methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 335ºC at 760mmHg |
| Melting Point | 58-62ºC(lit.) |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.27800 |
| Flash Point | 156.4ºC |
| Exact Mass | 251.11600 |
| PSA | 64.63000 |
| LogP | 2.36350 |
| Vapour Pressure | 0.000124mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | HVZNBHBPOHUKAF-NSHDSACASA-N |
| SMILES | COC(=O)C(NC(=O)Oc1ccccc1)C(C)C |
| Hazard Codes | F+,C |
|---|---|
| Risk Phrases | R12;R19;R34;R40;R36/37/38 |
| Safety Phrases | S16;S26;S29;S33;S45;S36/S37/S39 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00216574 |