2-(Chloromethyl)-3,5-dimethyl-4-nitropyridine structure
|
Common Name | 2-(Chloromethyl)-3,5-dimethyl-4-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 153476-68-7 | Molecular Weight | 200.622 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 326.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H9ClN2O2 | Melting Point | 125-126℃ (toluene ) | |
| MSDS | N/A | Flash Point | 151.4±26.5 °C | |
| Name | 2-(chloromethyl)-3,5-dimethyl-4-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.7±37.0 °C at 760 mmHg |
| Melting Point | 125-126℃ (toluene ) |
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.622 |
| Flash Point | 151.4±26.5 °C |
| Exact Mass | 200.035248 |
| PSA | 58.71000 |
| LogP | 1.51 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | TZDCRETVAXMALU-UHFFFAOYSA-N |
| SMILES | Cc1cnc(CCl)c(C)c1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 2-(chloromethyl)-3,5-dimethyl-4-nitro- |
| Pyridine,2-(chloromethyl)-3,5-dimethyl-4-nitro |
| 2-Chloromethyl-3,5-dimethyl-4-nitropyridine |
| 2-(Chloromethyl)-3,5-dimethyl-4-nitropyridine |
| Esomeprazole Impurity 40 |