(S)-N-BOC-TERT-LEUCINOL structure
|
Common Name | (S)-N-BOC-TERT-LEUCINOL | ||
|---|---|---|---|---|
| CAS Number | 153645-26-2 | Molecular Weight | 217.305 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 313.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H23NO3 | Melting Point | 102-103 °C | |
| MSDS | Chinese USA | Flash Point | 143.5±23.2 °C | |
| Name | (S)-(-)-N-BOC-tert-Leucinol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 313.7±25.0 °C at 760 mmHg |
| Melting Point | 102-103 °C |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.305 |
| Flash Point | 143.5±23.2 °C |
| Exact Mass | 217.167801 |
| PSA | 58.56000 |
| LogP | 2.06 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | AZHJHZWFJVBGIL-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)C(C)(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2924199090 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert-butyl N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]carbamate |
| 2-Methyl-2-propanyl [(2S)-1-hydroxy-3,3-dimethyl-2-butanyl]carbamate |
| Carbamic acid, N-[(1S)-1-(hydroxymethyl)-2,2-dimethylpropyl]-, 1,1-dimethylethyl ester |
| MFCD01861301 |