Carbamicacid,[(1S)-1-formyl-2,2-dimethylpropyl]-,1,1-dimethylethylester structure
|
Common Name | Carbamicacid,[(1S)-1-formyl-2,2-dimethylpropyl]-,1,1-dimethylethylester | ||
|---|---|---|---|---|
| CAS Number | 335627-99-1 | Molecular Weight | 215.289 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 290.0±23.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.2±22.6 °C | |
| Name | N-Boc-L-tert-leucinal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 290.0±23.0 °C at 760 mmHg |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.289 |
| Flash Point | 129.2±22.6 °C |
| Exact Mass | 215.152145 |
| PSA | 55.40000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.444 |
| InChIKey | VNUGLZHZXINMND-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C=O)C(C)(C)C |
| HS Code | 2924199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid, N-[(1S)-1-formyl-2,2-dimethylpropyl]-, 1,1-dimethylethyl ester |
| 20847 (S)-TERT-BUTYL 3,3-DIMETHYL-1-OXOBUTAN-2-YLCARBAMATE |
| (S)-N-Boc-tert-leucinal |
| 2-Methyl-2-propanyl [(2S)-3,3-dimethyl-1-oxo-2-butanyl]carbamate |
| (1S-Formyl-2,2-dimethyl-propyl)-carbamic acid tert-butyl ester |
| tert-butyl [(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| Carbamicacid,[(1S)-1-formyl-2,2-dimethylpropyl]-,1,1-dimethylethylester |
| (2S)-2-tert-butoxycarbonylamino-3,3-dimethylbutanal |