DOTA derivative structure
|
Common Name | DOTA derivative | ||
|---|---|---|---|---|
| CAS Number | 153777-70-9 | Molecular Weight | 879.139 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 959.5±75.0 °C at 760 mmHg | |
| Molecular Formula | C43H50N4O8S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 534.1±37.1 °C | |
Use of DOTA derivativeDOTA derivative is a benxyl derivative of the cyclic tosamide; can be nitrated directly; is more convenient to incorporate the nitro group after deprotection lithium aluminum hydride. |
| Name | DOTA derivative |
|---|---|
| Synonym | More Synonyms |
| Description | DOTA derivative is a benxyl derivative of the cyclic tosamide; can be nitrated directly; is more convenient to incorporate the nitro group after deprotection lithium aluminum hydride. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 959.5±75.0 °C at 760 mmHg |
| Molecular Formula | C43H50N4O8S4 |
| Molecular Weight | 879.139 |
| Flash Point | 534.1±37.1 °C |
| Exact Mass | 878.251160 |
| LogP | 9.75 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | STNZNCWQNMGRIM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(C)cc3)CCN(S(=O)(=O)c3ccc(C)cc3)C(Cc3ccccc3)CN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| Storage condition | 2-8℃ |
| 2-Benzyl-1,4,7,10-tetrakis[(4-methylphenyl)sulfonyl]-1,4,7,10-tetraazacyclododecane |
| 1,4,7,10-Tetraazacyclododecane, 1,4,7,10-tetrakis[(4-methylphenyl)sulfonyl]-2-(phenylmethyl)- |