2-(2-thiochroman-8-yloxyethyl)isoindole-1,3-dione structure
|
Common Name | 2-(2-thiochroman-8-yloxyethyl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 153804-50-3 | Molecular Weight | 339.40800 | |
| Density | 1.331g/cm3 | Boiling Point | 531.5ºC at 760mmHg | |
| Molecular Formula | C19H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.2ºC | |
| Name | 2-[2-(3,4-dihydro-2H-thiochromen-8-yloxy)ethyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 531.5ºC at 760mmHg |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.40800 |
| Flash Point | 275.2ºC |
| Exact Mass | 339.09300 |
| PSA | 71.91000 |
| LogP | 3.33780 |
| Vapour Pressure | 2.23E-11mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | VQZODWZMFPKNSJ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CCOc1cccc2c1SCCC2 |
|
~%
2-(2-thiochroma... CAS#:153804-50-3 |
| Literature: Adir et Compagnie Patent: US5332741 A1, 1994 ; US 5332741 A |
|
~%
2-(2-thiochroma... CAS#:153804-50-3 |
| Literature: Charton, Isabelle; Mamai, Ahmed; Bennejean, Caroline; Renard, Pierre; Howell, Edward H.; Guardiola-Lemaitre, B.Eatrice; Delagrange, Philippe; Morgan, Peter J.; Viaud, Marie-Claude; Guillaumet, G.Erald Bioorganic and Medicinal Chemistry, 2000 , vol. 8, # 1 p. 105 - 114 |
|
~%
2-(2-thiochroma... CAS#:153804-50-3 |
| Literature: Charton, Isabelle; Mamai, Ahmed; Bennejean, Caroline; Renard, Pierre; Howell, Edward H.; Guardiola-Lemaitre, B.Eatrice; Delagrange, Philippe; Morgan, Peter J.; Viaud, Marie-Claude; Guillaumet, G.Erald Bioorganic and Medicinal Chemistry, 2000 , vol. 8, # 1 p. 105 - 114 |
| 1H-Isoindole-1,3(2H)-dione,2-(2-((3,4-dihydro-2H-1-benzothiopyran-8-yl)oxy)ethyl) |
| 2-(2-THIOCHROMAN-8-YLOXYETHYL)ISOINDOLE-1,3-DIONE |
| 2-(2-((3,4-Dihydro-2H-1-benzothiopyran-8-yl)oxy)ethyl)-1H-isoindole-1,3(2H)-dione |
| 8-((2-Phthalimidoethyl)oxy)thiochroman |