Methyl 4-formyl-3-nitrobenzoate structure
|
Common Name | Methyl 4-formyl-3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 153813-69-5 | Molecular Weight | 209.156 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 380.0±32.0 °C at 760 mmHg | |
| Molecular Formula | C9H7NO5 | Melting Point | 62-66ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 190.2±27.1 °C | |
| Name | Methyl 4-formyl-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 380.0±32.0 °C at 760 mmHg |
| Melting Point | 62-66ºC(lit.) |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.156 |
| Flash Point | 190.2±27.1 °C |
| Exact Mass | 209.032425 |
| PSA | 89.19000 |
| LogP | 2.04 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | WGOOPYYIMZJWMA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C=O)c([N+](=O)[O-])c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918300090 |
|
~97%
Methyl 4-formyl... CAS#:153813-69-5 |
| Literature: Tetrahedron Letters, , vol. 35, # 2 p. 219 - 222 |
|
~67%
Methyl 4-formyl... CAS#:153813-69-5 |
| Literature: WO2005/66136 A1, ; Page/Page column 93-94 ; WO 2005/066136 A1 |
|
~%
Methyl 4-formyl... CAS#:153813-69-5 |
| Literature: Tetrahedron Letters, , vol. 35, # 2 p. 219 - 222 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzoic acid, 4-formyl-3-nitro-, methyl ester |
| Methyl 4-Formyl-3-Nitrobenzoate 97 |
| Methyl 4-formyl-3-nitrobenzoate |
| MFCD04039968 |