1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione structure
|
Common Name | 1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 15384-69-7 | Molecular Weight | 244.07400 | |
| Density | 1.517g/cm3 | Boiling Point | 471.4ºC at 760 mmHg | |
| Molecular Formula | C10H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.9ºC | |
| Name | 1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.517g/cm3 |
|---|---|
| Boiling Point | 471.4ºC at 760 mmHg |
| Molecular Formula | C10H7Cl2NO2 |
| Molecular Weight | 244.07400 |
| Flash Point | 238.9ºC |
| Exact Mass | 242.98500 |
| PSA | 37.38000 |
| LogP | 2.71180 |
| Vapour Pressure | 4.69E-09mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | CILRPNWGXZWSEA-UHFFFAOYSA-N |
| SMILES | O=C1CCC(=O)N1c1ccc(Cl)cc1Cl |
|
~%
1-(2,4-dichloro... CAS#:15384-69-7 |
| Literature: Campbell; Tryon Industrial and Engineering Chemistry, 1953 , vol. 45, p. 125,127 |
| N-(2,4-dichloro-phenyl)-succinimide |
| N-(2,4-Dichlor-phenyl)-succinimid |
| 1-(2,4-dichlorophenyl)azolidine-2,5-dione |
| 1-(2,4-Dichlor-phenyl)-2,5-dioxo-pyrrolidin |