Ethyl 4,6-dichloro-5-nitronicotinate structure
|
Common Name | Ethyl 4,6-dichloro-5-nitronicotinate | ||
|---|---|---|---|---|
| CAS Number | 154012-15-4 | Molecular Weight | 265.050 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 352.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H6Cl2N2O4 | Melting Point | 36-38°C | |
| MSDS | N/A | Flash Point | 167.3±26.5 °C | |
| Name | Ethyl 4,6-dichloro-5-nitronicotinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.9±37.0 °C at 760 mmHg |
| Melting Point | 36-38°C |
| Molecular Formula | C8H6Cl2N2O4 |
| Molecular Weight | 265.050 |
| Flash Point | 167.3±26.5 °C |
| Exact Mass | 263.970459 |
| PSA | 85.01000 |
| LogP | 1.52 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | VMNMZVKEDHEOEJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(Cl)c([N+](=O)[O-])c1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~70%
Ethyl 4,6-dichl... CAS#:154012-15-4 |
| Literature: Sanchez; Gogliotti Journal of Heterocyclic Chemistry, 1993 , vol. 30, # 4 p. 855 - 859 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 4,6-dichloro-5-nitronicotinate |
| ethyl 4,6-dichloro-5-nitropyridine-3-carboxylate |
| 3-Pyridinecarboxylic acid, 4,6-dichloro-5-nitro-, ethyl ester |