Algae bloom standard, Algae bloom toxin, Biotoxin, Cyanobacterial toxin structure
|
Common Name | Algae bloom standard, Algae bloom toxin, Biotoxin, Cyanobacterial toxin | ||
|---|---|---|---|---|
| CAS Number | 154037-70-4 | Molecular Weight | 986.16 | |
| Density | 1.25g/cm3 | Boiling Point | 1276.7ºC at 760mmHg | |
| Molecular Formula | C52H71N7O12 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 725.9ºC | |
Use of Algae bloom standard, Algae bloom toxin, Biotoxin, Cyanobacterial toxinMicrocystin-LF is a bacterial metabolite. Microcystin-LF is a phenylalanine variant of Microcystin-LR. Microcystin-LF has cellular toxicity on Caco-2 cells[1][2]. |
| Name | 15-benzyl-18-[(1E,3E)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-1,5,12,19-tetramethyl-2-methylidene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptazacyclopentacosane-11,22-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Microcystin-LF is a bacterial metabolite. Microcystin-LF is a phenylalanine variant of Microcystin-LR. Microcystin-LF has cellular toxicity on Caco-2 cells[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 1276.7ºC at 760mmHg |
| Molecular Formula | C52H71N7O12 |
| Molecular Weight | 986.16 |
| Flash Point | 725.9ºC |
| Exact Mass | 985.51600 |
| PSA | 299.68000 |
| LogP | 4.40080 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | FEVBMCJUKWWWBT-BNIOFCGNSA-N |
| SMILES | C=C1C(=O)NC(C)C(=O)NC(CC(C)C)C(=O)NC(C(=O)O)C(C)C(=O)NC(Cc2ccccc2)C(=O)NC(C=CC(C)=CC(C)C(Cc2ccccc2)OC)C(C)C(=O)NC(C(=O)O)CCC(=O)N1C |
| Storage condition | −20°C |
| Hazard Codes | F: Flammable;T: Toxic; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | S7 |
| RIDADR | UN 1230 3/PG 2 |
| Hazard Class | 3,6.1 |
| MFCD16661164 |