N,N-diethylethanamine,4-methylbenzenesulfonic acid structure
|
Common Name | N,N-diethylethanamine,4-methylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 15404-00-9 | Molecular Weight | 273.39200 | |
| Density | N/A | Boiling Point | 399.4ºC at 760mmHg | |
| Molecular Formula | C13H23NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.4ºC | |
| Name | N,N-diethylethanamine,4-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 399.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.39200 |
| Flash Point | 195.4ºC |
| Exact Mass | 273.14000 |
| PSA | 65.99000 |
| LogP | 3.67060 |
| Vapour Pressure | 4.27E-07mmHg at 25°C |
| InChIKey | MMVUZMIOJNPDME-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.Cc1ccc(S(=O)(=O)O)cc1 |
| HS Code | 2923900090 |
|---|
|
~0%
N,N-diethyletha... CAS#:15404-00-9 |
| Literature: Picard, C.; Cazaux, L.; Tisnes, P. Tetrahedron, 1986 , vol. 42, # 13 p. 3503 - 3520 |
|
~0%
N,N-diethyletha... CAS#:15404-00-9
Detail
|
| Literature: Przychodzen, Witold; Chojnacki, Jaroslaw Heteroatom Chemistry, 2008 , vol. 19, # 3 p. 271 - 282 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Triethylammonium p-toluenesulphonate |
| 4-Methylbenzenesulfonic acid,triethylamine salt |
| triethylammonium toluene-p-sulfonate |
| EINECS 239-421-1 |
| Benzenesulfonic acid,4-methyl-,compd. with N,N-diethylethanamine (1:1) |
| tosylate de triethylamine |
| triethylammonium 4-toluenesulfonate |
| triethylammonium tosylate |
| triethylamine p-toluenesulfonate |
| n,n-diethylethanaminium 4-methylbenzenesulfonate |
| triethylammonium p-toluenesulfonate |