Isormangostin structure
|
Common Name | Isormangostin | ||
|---|---|---|---|---|
| CAS Number | 15404-80-5 | Molecular Weight | 396.433 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 606.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.0±25.0 °C | |
| Name | 5,9-Dihydroxy-2,2,11,11-tetramethyl-3,4,12,13-tetrahydro-2H-dipyr ano[2,3-a:2',3'-j]xanthen-14(11H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 606.4±55.0 °C at 760 mmHg |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.433 |
| Flash Point | 213.0±25.0 °C |
| Exact Mass | 396.157288 |
| PSA | 89.13000 |
| LogP | 5.60 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | NAONXHGSDQDBNY-UHFFFAOYSA-N |
| SMILES | CC1(C)CCc2c(c(O)cc3oc4cc(O)c5c(c4c(=O)c23)OC(C)(C)CC5)O1 |
| Hazard Codes | Xi |
|---|
|
~%
Isormangostin CAS#:15404-80-5 |
| Literature: Yates; Stout Journal of the American Chemical Society, 1958 , vol. 80, p. 1691,1699 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-isomangostin hydrate |
| 2H-Dipyrano[2,3-a:2',3'-j]xanthen-14(11H)-one, 3,4,12,13-tetrahydro-5,9-dihydroxy-2,2,11,11-tetramethyl- |
| 5,9-Dihydroxy-2,2,11,11-tetramethyl-3,4,12,13-tetrahydro-2H-dipyrano[2,3-a:2',3'-j]xanthen-14(11H)-one |