tert-Butyl (2-methoxyphenyl)carbamate structure
|
Common Name | tert-Butyl (2-methoxyphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 154150-18-2 | Molecular Weight | 223.268 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 276.0±23.0 °C at 760 mmHg | |
| Molecular Formula | C12H17NO3 | Melting Point | 33.5-35.0 ℃ | |
| MSDS | Chinese USA | Flash Point | 120.7±22.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-butyl N-(2-methoxyphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 276.0±23.0 °C at 760 mmHg |
| Melting Point | 33.5-35.0 ℃ |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.268 |
| Flash Point | 120.7±22.6 °C |
| Exact Mass | 223.120850 |
| PSA | 47.56000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | DHSWMVURURVRDB-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NC(=O)OC(C)(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 22-36/37/38 |
| RIDADR | NONH for all modes of transport |
|
~97%
tert-Butyl (2-m... CAS#:154150-18-2 |
| Literature: Nakamura, Itaru; Yamagishi, Uichiro; Song, Dschun; Konta, Sayaka; Yamamoto, Yoshinori Angewandte Chemie - International Edition, 2007 , vol. 46, # 13 p. 2284 - 2287 |
|
~73%
tert-Butyl (2-m... CAS#:154150-18-2 |
| Literature: Vo, Giang D.; Hartwig, John F. Journal of the American Chemical Society, 2009 , vol. 131, # 31 p. 11049 - 11061 |
|
~10%
tert-Butyl (2-m... CAS#:154150-18-2 |
| Literature: Falk, Florian C.; Froehlich, Roland; Paradies, Jan Chemical Communications, 2011 , vol. 47, # 39 p. 11095 - 11097 |
|
~92%
tert-Butyl (2-m... CAS#:154150-18-2 |
| Literature: Isley, Nicholas A.; Dobarco, Sebastian; Lipshutz, Bruce H. Green Chemistry, 2014 , vol. 16, # 3 p. 1480 - 1488 |
| Precursor 5 | |
|---|---|
| DownStream 7 | |
| tert-Butyl (2-methoxyphenyl)carbamate |
| Carbamic acid, N-(2-methoxyphenyl)-, 1,1-dimethylethyl ester |
| N-(2-methoxyphenyl)-1,1-dimethylethyl ester carbamic acid |
| N-Boc-2-methoxyaniline |
| N-BOC-O-ANISIDINE |
| N-(tert-butoxycarbonyl)-2-methoxyaniline |
| (2-Mehtoxyphenyl)-carbamic acid, 1,1-dimethyl ethyl ester |
| 2-Methyl-2-propanyl (2-methoxyphenyl)carbamate |
| 2-t-butoxycarbonylamino-1-methoxybenzene |
| N-((o-methoxy)phenyl)-O-(tert-butyl)carbamate |
| N-(2-Methoxyphenyl)-Carbamic Acid 1,1-Dimethylethyl Ester |
| BOC-O-ANISIDINE |
| Tert-butyl 2-methoxyphenylcarbamate |
| t-butyl (o-methoxyphenyl)carbamate |
| (2-Mehtoxyphenyl)-carbamic acid,1,1-dimethyl ethyl ester |
| AmbkkkkK259 |