2,4(1H,3H)-Pyrimidinedione,6-phenoxy- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-phenoxy- | ||
|---|---|---|---|---|
| CAS Number | 15422-04-5 | Molecular Weight | 204.18200 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-phenoxy-1H-pyrimidine-2,4-dione |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18200 |
| Exact Mass | 204.05300 |
| PSA | 74.95000 |
| LogP | 0.85550 |
| Index of Refraction | 1.588 |
| InChIKey | VLATWUZGXHPDLF-UHFFFAOYSA-N |
| SMILES | O=c1cc(Oc2ccccc2)[nH]c(=O)[nH]1 |
|
~54%
2,4(1H,3H)-Pyri... CAS#:15422-04-5 |
| Literature: Yoneda, Fumio; Hirayama, Ryiochi; Yamashita, Machiko Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 301 - 304 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |