1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol
Modify Date: 2025-09-10 11:42:55
![1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol Structure](https://www.chemsrc.com/extcaspic/176/1543386-46-4.png)
1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol structure
|
Common Name | 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 1543386-46-4 | Molecular Weight | 223.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16F3NO |
|---|---|
| Molecular Weight | 223.24 |
| InChIKey | HRFKVFSSAMOPPZ-UHFFFAOYSA-N |
| SMILES | OC(CN1CC2CCCC2C1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol? |
| A: The English name of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol is 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol. |
| Q: What is the Chinese name of 1543386-46-4? |
| A: Chinese name of 1543386-46-4 is 1543386-46-4. |
| Q: What is the molecular formula of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol? |
| A: Molecular formula of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol is C10H16F3NO. |
| Q: What is the InChIKey of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol? |
| A: InChIKey of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol is HRFKVFSSAMOPPZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol? |
| A: CAS number of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol is 1543386-46-4. |
| Q: What is the molecular weight of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol? |
| A: Molecular weight of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol is 223.24. |
| Q: What is the SMILES notation of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol? |
| A: SMILES notation of 1,1,1-Trifluoro-3-{octahydrocyclopenta[c]pyrrol-2-yl}propan-2-ol is OC(CN1CC2CCCC2C1)C(F)(F)F. |