FMOC-Arg(Pbf)-OH structure
|
Common Name | FMOC-Arg(Pbf)-OH | ||
|---|---|---|---|---|
| CAS Number | 154445-77-9 | Molecular Weight | 648.769 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C34H40N4O7S | Melting Point | 132°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of FMOC-Arg(Pbf)-OHFmoc-Arg(Pbf)-OH is an arginine derivative containing amine protecting group Fmoc. Fmoc-Arg(Pbf)-OH is a building block for the introduction of Arg into SPPS (Solid-Phase Peptide Synthesis)[1]. |
| Name | (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Arg(Pbf)-OH is an arginine derivative containing amine protecting group Fmoc. Fmoc-Arg(Pbf)-OH is a building block for the introduction of Arg into SPPS (Solid-Phase Peptide Synthesis)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Melting Point | 132°C |
| Molecular Formula | C34H40N4O7S |
| Molecular Weight | 648.769 |
| Exact Mass | 648.261780 |
| PSA | 175.29000 |
| LogP | 6.86 |
| Index of Refraction | 1.649 |
| InChIKey | HNICLNKVURBTKV-NDEPHWFRSA-N |
| SMILES | Cc1c(C)c(S(=O)(=O)NC(N)=NCCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c(C)c2c1OC(C)(C)C2 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Chemical synthesis of a polypeptide backbone derived from the primary sequence of the cancer protein NY-ESO-1 enabled by kinetically controlled ligation and pseudoprolines.
Biopolymers 104 , 116-27, (2015) The cancer protein NY-ESO-1 has been shown to be one of the most promising vaccine candidates although little is known about its cellular function. Using a chemical protein strategy, the 180 amino aci... |
|
|
A new class of peptidomimetics targeting the polo-box domain of Polo-like kinase 1.
J. Med. Chem. 58(1) , 294-304, (2015) Recent progress in the development of peptide-derived Polo-like kinase (Plk1) polo-box domain (PBD) inhibitors has led to the synthesis of multiple peptide ligands with high binding affinity and selec... |
|
|
Internalization of Near-Infrared Fluorescently Labeled Activatable Cell-Penetrating Peptide and of Proteins into Human Fibrosarcoma Cell Line HT-1080.
J. Cell. Biochem. 116 , 1222-31, (2015) The internalization of near-infrared fluorescently labeled cargos into living cells and tissues allows a highly sensitive detection without interference from skin, porphins or other fluorescent cell a... |
| Nalpha-Fmoc-Nomega-Pbf-L-arginine |
| Nα-Fmoc-Nω-Pbf-L-arginine |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-{N-[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]carbamimidoyl}-L-ornithine |
| Na-Fmoc-Nw-Pbf-L-arginine |
| Fmoc-Arg(Pbf)-OH |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-{N'-[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]carbamimidamido}pentanoic acid |
| MFCD00235804 |
| L-Ornithine, N-[[[(2,3-dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-L-Arg(Pbf)-OH |