2-(Perfluoroundecyl)ethylalcohol structure
|
Common Name | 2-(Perfluoroundecyl)ethylalcohol | ||
|---|---|---|---|---|
| CAS Number | 1545-59-1 | Molecular Weight | 614.14100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H5F23O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tricosafluorotridecan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H5F23O |
|---|---|
| Molecular Weight | 614.14100 |
| Exact Mass | 613.99700 |
| PSA | 20.23000 |
| LogP | 7.28410 |
| InChIKey | IGLKFKBLLGNRCU-UHFFFAOYSA-N |
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
2-(Perfluoround... CAS#:1545-59-1 |
| Literature: Brace,N.O. Journal of Organic Chemistry, 1962 , vol. 27, p. 3033 - 3038 |
|
~%
2-(Perfluoround... CAS#:1545-59-1 |
| Literature: Brace,N.O. Journal of Organic Chemistry, 1962 , vol. 27, p. 3033 - 3038 |
| 2-(Perfluoroundecyl)ethylalcohol |
| 1H,1H,2H,2H-tricosafluoro-tridecan-1-ol |
| 1-Tridecanol,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tricosafluoro |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-Tricosafluor-tridecanol-(1) |