2-hydroxy-5-(1,2,2,2-tetrachloroethyl)benzoic acid structure
|
Common Name | 2-hydroxy-5-(1,2,2,2-tetrachloroethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6330-47-8 | Molecular Weight | 303.95400 | |
| Density | 1.692g/cm3 | Boiling Point | 419.7ºC at 760 mmHg | |
| Molecular Formula | C9H6Cl4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
| Name | 5-<1,2,2,2-Tetrachlor-aethyl>-2-hydroxy-benzoesaeure |
|---|---|
| Synonym | More Synonyms |
| Density | 1.692g/cm3 |
|---|---|
| Boiling Point | 419.7ºC at 760 mmHg |
| Molecular Formula | C9H6Cl4O3 |
| Molecular Weight | 303.95400 |
| Flash Point | 207.6ºC |
| Exact Mass | 301.90700 |
| PSA | 57.53000 |
| LogP | 3.74050 |
| Index of Refraction | 1.631 |
| InChIKey | MIDTWVMBRMCBLH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(Cl)C(Cl)(Cl)Cl)ccc1O |
|
~%
2-hydroxy-5-(1,... CAS#:6330-47-8 |
| Literature: Dharwarkar; Alimchandani Journal of the Indian Chemical Society, 1940 , vol. 17, p. 416,419 |
|
~%
2-hydroxy-5-(1,... CAS#:6330-47-8 |
| Literature: Dharwarkar; Alimchandani Journal of the Indian Chemical Society, 1940 , vol. 17, p. 416,419 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-tert.Octyl-2-hydroxy-thiophenol |
| 2-Hydroxy-5-<1,2,2,2-tetrachlor-aethyl>-benzoesaeure |