1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethanone structure
|
Common Name | 1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethanone | ||
|---|---|---|---|---|
| CAS Number | 154598-53-5 | Molecular Weight | 223.580 | |
| Density | 1.475g/cm3 | Boiling Point | 282.279°C at 760 mmHg | |
| Molecular Formula | C8H5ClF3NO | Melting Point | 90-91°C | |
| MSDS | N/A | Flash Point | 124.518°C | |
| Name | 4-Chloro-2-trifluoroacetylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.475g/cm3 |
|---|---|
| Boiling Point | 282.279°C at 760 mmHg |
| Melting Point | 90-91°C |
| Molecular Formula | C8H5ClF3NO |
| Molecular Weight | 223.580 |
| Flash Point | 124.518°C |
| Exact Mass | 223.001175 |
| PSA | 43.09000 |
| LogP | 3.17 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | NOKSRMDODJGCPZ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)cc1C(=O)C(F)(F)F |
| HS Code | 2922399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethanone |
| Ethanone, 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro- |
| 2-trifluoroacetyl-4-chloro aniline |