3-Methoxymollugin structure
|
Common Name | 3-Methoxymollugin | ||
|---|---|---|---|---|
| CAS Number | 154706-44-2 | Molecular Weight | 314.33 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 505.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H18O5 | Melting Point | 119.5-121℃ | |
| MSDS | N/A | Flash Point | 184.8±23.6 °C | |
Use of 3-Methoxymollugin3-methoxymollugin is a compound that can be isolated from Rubia cordifolia and is cytotoxic[1].. |
| Name | methyl 6-hydroxy-3-methoxy-2,2-dimethyl-2H-benzo[h]chromene-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | 3-methoxymollugin is a compound that can be isolated from Rubia cordifolia and is cytotoxic[1].. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 505.7±50.0 °C at 760 mmHg |
| Melting Point | 119.5-121℃ |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.33 |
| Flash Point | 184.8±23.6 °C |
| Exact Mass | 314.115417 |
| PSA | 64.99000 |
| LogP | 5.41 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | OCQKAHAAVZGZPO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c2c(c3ccccc3c1O)OC(C)(C)C(OC)=C2 |
| Hazard Codes | Xi |
|---|
| Methyl 6-hydroxy-3-methoxy-2,2-dimethyl-2H-benzo[h]chromene-5-carboxylate |
| 2H-Naphtho[1,2-b]pyran-5-carboxylic acid, 6-hydroxy-3-methoxy-2,2-dimethyl-, methyl ester |