Acetamide,N-(5-fluoro-2,4-dinitrophenyl)- structure
|
Common Name | Acetamide,N-(5-fluoro-2,4-dinitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1548-18-1 | Molecular Weight | 243.14900 | |
| Density | 1.616g/cm3 | Boiling Point | 460.3ºC at 760mmHg | |
| Molecular Formula | C8H6FN3O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 232.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(5-fluoro-2,4-dinitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.616g/cm3 |
|---|---|
| Boiling Point | 460.3ºC at 760mmHg |
| Molecular Formula | C8H6FN3O5 |
| Molecular Weight | 243.14900 |
| Flash Point | 232.2ºC |
| Exact Mass | 243.02900 |
| PSA | 120.74000 |
| LogP | 2.71990 |
| Vapour Pressure | 1.17E-08mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | LZBXUWOTXPNTNQ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(F)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
|
~%
Acetamide,N-(5-... CAS#:1548-18-1 |
| Literature: Bergmann; Bentov Bl.Res.Coun.Israel, 1952 , vol. 2, p. 280 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4-Dinitro-5-fluoroacetanilide |
| acetic acid-(5-fluoro-2,4-dinitro-anilide) |
| Essigsaeure-(5-fluor-2,4-dinitro-anilid) |
| 2,4-Dinitro-5-fluor-acetanilid |