1-Azido-2-(trifluoromethyl)benzene solution structure
|
Common Name | 1-Azido-2-(trifluoromethyl)benzene solution | ||
|---|---|---|---|---|
| CAS Number | 1548-68-1 | Molecular Weight | 187.12200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4F3N3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | -33℃ | |
| Symbol |
GHS02, GHS07, GHS08 |
Signal Word | Danger | |
| Name | 1-Azido-2-(trifluoromethyl)benzene solution |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4F3N3 |
|---|---|
| Molecular Weight | 187.12200 |
| Flash Point | -33℃ |
| Exact Mass | 187.03600 |
| PSA | 49.75000 |
| LogP | 3.09996 |
| InChIKey | KNPDKRVXJOVOQP-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccccc1C(F)(F)F |
| Storage condition | -20℃ |
| Symbol |
GHS02, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H315-H319-H372 |
| Precautionary Statements | P210-P305 + P351 + P338-P314 |
| Risk Phrases | 11-38-48/23/24/25 |
| RIDADR | UN 2398 3 / PGII |
| HS Code | 2929909090 |
|
~94%
1-Azido-2-(trif... CAS#:1548-68-1 |
| Literature: LIFE and BRAIN GMBH; MUeLLER, Christa; ZIMMER, Andreas; LABS, Stefanie; BUCHHOLZ, Stephanie; HINZ, Sonja Patent: WO2012/76974 A1, 2012 ; Location in patent: Page/Page column 36-37 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Organic azides: an exploding diversity of a unique class of compounds.
Angew. Chem. Int. Ed. Engl. 44 , 5188-5240, (2005) Since the discovery of organic azides by Peter Griess more than 140 years ago, numerous syntheses of these energy-rich molecules have been developed. In more recent times in particular, completely new... |
| 1-Azido-2-(trifluoromethyl)benzene |