Pentafluorophenyl Benzoate structure
|
Common Name | Pentafluorophenyl Benzoate | ||
|---|---|---|---|---|
| CAS Number | 1548-84-1 | Molecular Weight | 288.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H5F5O2 | Melting Point | 74 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,4,5,6-pentafluorophenyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 74 °C |
|---|---|
| Molecular Formula | C13H5F5O2 |
| Molecular Weight | 288.17000 |
| Exact Mass | 288.02100 |
| PSA | 26.30000 |
| LogP | 3.60130 |
| InChIKey | WZPWTXZSQHIABL-UHFFFAOYSA-N |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| HS Code | 2916310090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Perfluorophenyl benzoate |