Vinyl 4-tert-Butylbenzoate structure
|
Common Name | Vinyl 4-tert-Butylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 15484-80-7 | Molecular Weight | 204.26500 | |
| Density | 0.999 g/mL at 25 °C(lit.) | Boiling Point | 100 °C0.5 mm Hg(lit.) | |
| Molecular Formula | C13H16O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | 4-tert-butylbenzoic acid vinyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 0.999 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 100 °C0.5 mm Hg(lit.) |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.26500 |
| Flash Point | >230 °F |
| Exact Mass | 204.11500 |
| PSA | 26.30000 |
| LogP | 3.28440 |
| Vapour Pressure | 0.0031mmHg at 25°C |
| Index of Refraction | n20/D 1.518(lit.) |
| InChIKey | ZLHVSEPPILCZHH-UHFFFAOYSA-N |
| SMILES | C=COC(=O)c1ccc(C(C)(C)C)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 239-510-5 |
| MFCD00080692 |
| Vinyl 4-tert-Butylbenzoate |
| ethenyl 4-tert-butylbenzoate |
| 4-tert-Butylbenzoic Acid Vinyl Ester |