2-pyridin-4-yl-benzothiazol-6-ylamine structure
|
Common Name | 2-pyridin-4-yl-benzothiazol-6-ylamine | ||
|---|---|---|---|---|
| CAS Number | 154851-85-1 | Molecular Weight | 227.28500 | |
| Density | 1.36g/cm3 | Boiling Point | 470.5ºC at 760 mmHg | |
| Molecular Formula | C12H9N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.3ºC | |
| Name | 2-pyridin-4-yl-benzothiazol-6-ylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 470.5ºC at 760 mmHg |
| Molecular Formula | C12H9N3S |
| Molecular Weight | 227.28500 |
| Flash Point | 238.3ºC |
| Exact Mass | 227.05200 |
| PSA | 80.04000 |
| LogP | 3.52170 |
| Vapour Pressure | 5.06E-09mmHg at 25°C |
| Index of Refraction | 1.741 |
| InChIKey | KXYTYOFVZMOYHG-UHFFFAOYSA-N |
| SMILES | Nc1ccc2nc(-c3ccncc3)sc2c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2934200090 |
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-benzothiazolamine,2-(4-pyridinyl) |