Benzenesulfonicacid, 4-methyl-, 2-(2,2,5,5-tetramethyl-3-oxocyclohexylidene)hydrazide structure
|
Common Name | Benzenesulfonicacid, 4-methyl-, 2-(2,2,5,5-tetramethyl-3-oxocyclohexylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 15500-76-2 | Molecular Weight | 336.44900 | |
| Density | 1.19g/cm3 | Boiling Point | 467.2ºC at 760mmHg | |
| Molecular Formula | C17H24N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.4ºC | |
| Name | 4-methyl-N-[(Z)-(2,2,5,5-tetramethyl-3-oxocyclohexylidene)amino]benzenesulfonamide |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 467.2ºC at 760mmHg |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.44900 |
| Flash Point | 236.4ºC |
| Exact Mass | 336.15100 |
| PSA | 83.98000 |
| LogP | 4.51630 |
| Vapour Pressure | 6.63E-09mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | SDDNDZSHMKXSMT-JXAWBTAJSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=C2CC(C)(C)CC(=O)C2(C)C)cc1 |
|
~%
Benzenesulfonic... CAS#:15500-76-2 |
| Literature: Krief, Alain; Jeanmart, Stephane; Gondal, Humaira Y.; Kremer, Adrian Helvetica Chimica Acta, 2012 , vol. 95, # 11 p. 2123 - 2167 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|