Medone, dimethyl- structure
|
Common Name | Medone, dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 702-50-1 | Molecular Weight | 168.23300 | |
| Density | 0.954g/cm3 | Boiling Point | 245.8ºC at 760 mmHg | |
| Molecular Formula | C10H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.1ºC | |
| Name | 2,2,5,5-tetramethylcyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 0.954g/cm3 |
|---|---|
| Boiling Point | 245.8ºC at 760 mmHg |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.23300 |
| Flash Point | 90.1ºC |
| Exact Mass | 168.11500 |
| PSA | 34.14000 |
| LogP | 1.97080 |
| Index of Refraction | 1.441 |
| InChIKey | RMYOPLPHLGBSCY-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C(C)(C)C(=O)C1 |
|
~63%
Medone, dimethyl- CAS#:702-50-1 |
| Literature: Krief; Surleraux; Frauenrath Tetrahedron Letters, 1988 , vol. 29, # 47 p. 6157 - 6160 |
|
~93%
Medone, dimethyl- CAS#:702-50-1 |
| Literature: Tomioka, Hiroki; Oshima, Koichiro; Nozaki, Hitoshi Tetrahedron Letters, 1982 , vol. 23, # 1 p. 99 - 100 |
|
~%
Medone, dimethyl- CAS#:702-50-1 |
| Literature: Arnett, Edward M.; Maroldo, Stephen G.; Schriver, George W.; Schilling, Steven L.; Troughton, E. B. Journal of the American Chemical Society, 1985 , vol. 107, p. 2091 - 2099 |
|
~%
Medone, dimethyl- CAS#:702-50-1 |
| Literature: Hirsjaervi Annales Academiae Scientiarum Fennicae, Series A2: Chemica, 1946 , # 23 p. 83 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| Methone,dimethyl |
| 1,3-Cyclohexanedione,2,2,5,5-tetramethyl |
| 2,2,5,5-Tetramethyl-1,3-cyclohexanedione |
| 2,2,5,5-tetramethyl-cyclohexane-1,3-dione |
| 2,2,5,5-Tetramethyl-cyclohexan-1,3-dion |
| dimethyl dimedone |
| 2,2,5,5-tetramethylcyclohexa-1,3-dione |
| 2,2-dimethyl dimedone |
| 2,5,5-Tetramethyl-1,3-cyclohexanedione |
| Medone,dimethyl |
| 1,2,2,5,5-tetramethyl |