4,4'-Dimethyl-2,2'-bi(phenol) structure
|
Common Name | 4,4'-Dimethyl-2,2'-bi(phenol) | ||
|---|---|---|---|---|
| CAS Number | 15519-73-0 | Molecular Weight | 214.26000 | |
| Density | 1.163g/cm3 | Boiling Point | 338.8ºC at 760 mmHg | |
| Molecular Formula | C14H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.8ºC | |
| Name | 2-(2-hydroxy-5-methylphenyl)-4-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 338.8ºC at 760 mmHg |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26000 |
| Flash Point | 159.8ºC |
| Exact Mass | 214.09900 |
| PSA | 40.46000 |
| LogP | 3.38160 |
| Vapour Pressure | 4.87E-05mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | JIONXXHMDHBECT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(-c2cc(C)ccc2O)c1 |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4-methyl-2-(5-methyl-2-hydroxyphenyl)phenol |
| 2,2'-Dihydroxy-4,4'-dimethylbiphenyl |
| 2,2'-dihydroxy-5,5'-dimethyldiphenyl |
| 2,2'-dihydroxy-5,5'-dimethyl-1,1'-biphenyl |
| 2,2'-Dihydroxy-5,5'-dimethylbiphenyl |
| 5,5'-dimethyl[1,1'-biphenyl]-2,2'-diol |