4-(N,N-Diethylamino)cinnamic acid structure
|
Common Name | 4-(N,N-Diethylamino)cinnamic acid | ||
|---|---|---|---|---|
| CAS Number | 1552-97-2 | Molecular Weight | 219.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[4-(diethylamino)phenyl]prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28000 |
| Exact Mass | 219.12600 |
| PSA | 40.54000 |
| LogP | 2.63060 |
| InChIKey | MNUCAAWKJBVDCA-JXMROGBWSA-N |
| SMILES | CCOC(=O)C=Cc1ccc(N(C)C)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (E)-3-[4-(dimethylamino)phenyl]-2-propenoic acid ethyl ester |
| (E)-3-(4-(DIETHYLAMINO)PHENYL)ACRYLIC ACID |
| 3-[4-(dimethylamino)phenyl]-2-propenoic acid ethyl ester |
| (E)-3-(4-dimethylammino-phenyl)acrylic acid ethyl ester |
| (2E)-3-[4-(diethylamino)phenyl]acrylic acid |
| 2-Propenoic acid,3-[4-(diethylamino)phenyl] |
| ethyl (E)-3-(N,N-dimethyl-4-aminophenyl)-2-propenoate |
| 3-(4'-dimethylaminophenyl)-(E)-propenoic acid ethyl ester |