5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one
Modify Date: 2026-07-13 09:21:17
5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one structure
|
Common Name | 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 1553559-43-5 | Molecular Weight | 214.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22O3 |
|---|---|
| Molecular Weight | 214.30 |
| InChIKey | XXJCFGOITAZESY-UHFFFAOYSA-N |
| SMILES | CCOC(OCC)C1CCC(C)(C)C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one? |
| A: SMILES notation of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one is CCOC(OCC)C1CCC(C)(C)C1=O. |
| Q: What is the molecular weight of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one? |
| A: Molecular weight of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one is 214.30. |
| Q: What is the CAS number of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one? |
| A: CAS number of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one is 1553559-43-5. |
| Q: What is the molecular formula of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one? |
| A: Molecular formula of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one is C12H22O3. |
| Q: What is the English name of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one? |
| A: The English name of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one is 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one. |
| Q: What is the Chinese name of 1553559-43-5? |
| A: Chinese name of 1553559-43-5 is 1553559-43-5. |
| Q: What is the InChIKey of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one? |
| A: InChIKey of 5-(Diethoxymethyl)-2,2-dimethylcyclopentan-1-one is XXJCFGOITAZESY-UHFFFAOYSA-N. |