diphenylsilyloxy(diphenyl)silane
diphenylsilyloxy(diphenyl)silane structure
|
Common Name | diphenylsilyloxy(diphenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 15545-80-9 | Molecular Weight | 382.60200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H22OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diphenylsilyloxy(diphenyl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H22OSi2 |
|---|---|
| Molecular Weight | 382.60200 |
| Exact Mass | 382.12100 |
| PSA | 9.23000 |
| LogP | 2.07940 |
| InChIKey | SCTQCPWFWDWNTC-UHFFFAOYSA-N |
| SMILES | c1ccc([SiH](O[SiH](c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Disiloxane,1,1,3,3-tetraphenyl |
| tetraphenyldisiloxane |
| HSiPh2OSiPh2H |
| tetraphenyl-1,1,3,3-disiloxane |
| HPh2SiOSiPh2H |
| 1,1,3,3-tetraphenyl-disiloxane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of diphenylsilyloxy(diphenyl)silane? |
| A: LogP of diphenylsilyloxy(diphenyl)silane is 2.07940. |
| Q: What is the Chinese name of 15545-80-9? |
| A: Chinese name of 15545-80-9 is 15545-80-9. |
| Q: What is the SMILES notation of diphenylsilyloxy(diphenyl)silane? |
| A: SMILES notation of diphenylsilyloxy(diphenyl)silane is c1ccc([SiH](O[SiH](c2ccccc2)c2ccccc2)c2ccccc2)cc1. |
| Q: What is the polar surface area (PSA) of diphenylsilyloxy(diphenyl)silane? |
| A: Polar surface area (PSA) of diphenylsilyloxy(diphenyl)silane is 9.23000. |
| Q: What is the molecular weight of diphenylsilyloxy(diphenyl)silane? |
| A: Molecular weight of diphenylsilyloxy(diphenyl)silane is 382.60200. |
| Q: What is the CAS number of diphenylsilyloxy(diphenyl)silane? |
| A: CAS number of diphenylsilyloxy(diphenyl)silane is 15545-80-9. |
| Q: What is the molecular formula of diphenylsilyloxy(diphenyl)silane? |
| A: Molecular formula of diphenylsilyloxy(diphenyl)silane is C24H22OSi2. |
| Q: What is the English name of diphenylsilyloxy(diphenyl)silane? |
| A: The English name of diphenylsilyloxy(diphenyl)silane is diphenylsilyloxy(diphenyl)silane. |
| Q: What is the InChIKey of diphenylsilyloxy(diphenyl)silane? |
| A: InChIKey of diphenylsilyloxy(diphenyl)silane is SCTQCPWFWDWNTC-UHFFFAOYSA-N. |
| Q: What English synonyms does diphenylsilyloxy(diphenyl)silane have? |
| A: English synonyms of diphenylsilyloxy(diphenyl)silane: Disiloxane,1,1,3,3-tetraphenyl, tetraphenyldisiloxane, HSiPh2OSiPh2H, tetraphenyl-1,1,3,3-disiloxane, HPh2SiOSiPh2H, 1,1,3,3-tetraphenyl-disiloxane. |